| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Bromo-1,8-naphthalic anhydride Basic information |
| Product Name: | 3-Bromo-1,8-naphthalic anhydride | | Synonyms: | 5-BroMobenzo[de]isochroMene-1,3-dione;1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 5-broMo-;3-Bromo-1,8-phthalic anhydride;7-bromo-3-oxatricyclo[7.3.1.0,13]trideca-1(13),5,7,9,11-pentaene-2,4-dione;3-bromonaphthalic-1,8-anhydride;7-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;11-bromo-3-oxatricyclo[7.3.1.0a?μ,?1?3]trideca-1(13),5,7,9,11-pentaene-2,4-dione;2,2'-Biquinoline-4,4'-diyl bis(germane) | | CAS: | 24050-49-5 | | MF: | C12H5BrO3 | | MW: | 277.07 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 24050-49-5.mol |  |
| | 3-Bromo-1,8-naphthalic anhydride Chemical Properties |
| Melting point | 244-246°C | | Boiling point | 468.9±28.0 °C(Predicted) | | density | 1.812±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at room temperature | | Appearance | White to yellow Solid | | Sensitive | Moisture Sensitive | | BRN | 180001 | | InChI | InChI=1S/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H | | InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=CC(Br)=CC3=C2C1=CC=C3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Bromo-1,8-naphthalic anhydride Usage And Synthesis |
| Description | 3-Bromo-1,8-naphthalic anhydride is a naphthalic anhydride compound. Its structure incorporates a bromo functional group, meaning this product can participate in various chemical reactions and serve as a synthetic reagent for preparing photocatalysts, pharmaceutical preparations, or other organic heterocyclic compounds. | | Uses | 3-Bromo-1,8-naphthalic Anhydride is used in the preparation of novel NK1/NK2 antagonists. Also used in the synthesis of antitumor active a;lanediamines. |
| | 3-Bromo-1,8-naphthalic anhydride Preparation Products And Raw materials |
|