|
|
| | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide Basic information |
| | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide Chemical Properties |
| Melting point | 193-195 °C (lit.) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Water Solubility | Soluble in water | | form | solid | | color | White to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 4117571 | | InChI | InChI=1S/C24H26O2P.BrH/c1-4-11-21(12-5-1)27(22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-25-18-10-19-26-24;/h1-9,11-16,24H,10,17-20H2;1H/q+1;/p-1 | | InChIKey | XETDBHNHTOJWPZ-UHFFFAOYSA-M | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)CCC1OCCCO1.[Br-] | | CAS DataBase Reference | 69891-92-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2931599090 | | Storage Class | 11 - Combustible Solids |
| | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide Usage And Synthesis |
| Chemical Properties | white to light brown powder | | Uses | [2-(1,3-Dioxan-2-yl)ethyl]triphenylphosphonium Bromide is used in synthesis of leukotrienes. | | Uses | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide can be used:
- As a three-carbon homologating agent used to prepare α,β- or β,γ- unsaturated compounds.
- In the olefination of methyl 5-oxopentanoate to yield methyl 7-(1,3-dioxan2-yl)hept-(5Z)-enoate.
- As a cathode interfacial layer material in polymer solar cells.
| | reaction suitability | reaction type: C-C Bond Formation |
| | 2-(1,3-Dioxan-2-yl)ethyltriphenylphosphonium bromide Preparation Products And Raw materials |
|