- Praeruptorin A
-
- $73.00
-
2026-07-27
- CAS:73069-27-9
- Purity: 99.65%
- Supply Ability: 10g
|
| | (+)-Praeruptorin A Basic information |
| Product Name: | (+)-Praeruptorin A | | Synonyms: | (Z)-2-Methyl-2-butenoic acid [(9S,10S)-10β-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran]-9β-yl ester;9,10-Dihydro-9β-[(Z)-1-oxo-2-methyl-2-butenyloxy]-10β-(acetyloxy)-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b']dipyran-2-one;3,4-b']dipyran-9-ylester, (2Z)-;benzo[1,2-b:3,4-b']dipyran-9-ylester, (2Z)-;3,4-b'dipyran-9-ylester;2-Butenoic acid, 2-methyl-, (9S,10S)-10-(acetyloxy)-9,10-dihydro-8,8-dimethyl-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester, (2Z)-;(+)-Praeruptorin A;(9S,10S)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl](Z)-2-methylbut-2-enoate | | CAS: | 73069-27-9 | | MF: | C21H22O7 | | MW: | 386.4 | | EINECS: | | | Product Categories: | | | Mol File: | 73069-27-9.mol |  |
| | (+)-Praeruptorin A Chemical Properties |
| Melting point | 136-137 °C(Solv: ethanol (64-17-5)) | | Boiling point | 486.8±45.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | White to off-white | | InChI | InChI=1S/C21H22O7/c1-6-11(2)20(24)27-19-18(25-12(3)22)16-14(28-21(19,4)5)9-7-13-8-10-15(23)26-17(13)16/h6-10,18-19H,1-5H3/b11-6-/t18-,19-/m0/s1 | | InChIKey | XGPBRZDOJDLKOT-NXIDYTHLSA-N | | SMILES | C(O[C@@H]1C(C)(C)OC2=CC=C3C=CC(=O)OC3=C2[C@@H]1OC(C)=O)(=O)/C(/C)=C\C |
| | (+)-Praeruptorin A Usage And Synthesis |
| Chemical Properties | White needle-like crystals, fat-soluble, easily soluble in organic solvents. | | Uses | Praeruptorin A (Standard) is the analytical standard of Praeruptorin A. This product is intended for research and analytical applications. Praeruptorin A is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin A exerts anti-inflammatory effects in vitro through inhibition of NF-κB activation. | | Biological Activity | Praeruptorin A is a major bioactive constituent of Peucedanum praeruptorum. It exerts anti-inflammatory effects by inhibiting NF-κB activation. | | target | |
| | (+)-Praeruptorin A Preparation Products And Raw materials |
|