|
|
| | (R)-(+)-2-AMINOMETHYL-1-ETHYLPYRROLIDINE Basic information |
| | (R)-(+)-2-AMINOMETHYL-1-ETHYLPYRROLIDINE Chemical Properties |
| Boiling point | 50-52 °C(lit.) | | density | 0.90 | | refractive index | 1.4655-1.4675 | | Fp | 57 °C | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Hexane , Methanol | | form | Liquid | | pka | 10.04±0.40(Predicted) | | color | Clear colorless to yellow | | Sensitive | Hygroscopic | | InChI | InChI=1S/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3/t7-/m1/s1 | | InChIKey | UNRBEYYLYRXYCG-SSDOTTSWSA-N | | SMILES | N1(CC)CCC[C@@H]1CN | | CAS DataBase Reference | 22795-97-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 37/39-26-36-39-60-36/37/39-23 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | HazardClass | 8 | | HS Code | 29339900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | (R)-(+)-2-AMINOMETHYL-1-ETHYLPYRROLIDINE Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow liquid | | Uses | R-(+)-2-Aminomethyl-N-ethylpyrrolidine, is a chiral building block used for the synthesis of various biologically active compounds, such as Amisulpride (A633250). It can also be used for the synthesis of several novel heterocyclic-fused naphthalimides intercalators with chiral amino side chains, acting as antitumor agents. |
| | (R)-(+)-2-AMINOMETHYL-1-ETHYLPYRROLIDINE Preparation Products And Raw materials |
|