| Company Name: |
MarsLab Gold |
| Tel: |
17549219037 17549219037 |
| Email: |
2572406736@qq.com |
|
| | H-Gly-Pro-Hyp-OH Basic information | | Purity |
| Product Name: | H-Gly-Pro-Hyp-OH | | Synonyms: | (2S,4R)-1-((S)-1-(2-aMinoacetyl)pyrrolidine-2-carbonyl)-4-hydroxypyrrolidine-2-carboxylic acid;CollagenTripeptide;GLY-PRO-HYDROXY-PRO;gly-pro-hydroxy-pro W/approx.*6% isopropanol;Glycylprolylhydroxyproline;L-Proline,glycyl-L-prolyl-4-hydroxy-, (4R)-;(4R)-Glycyl-L-prolyl-4-hydroxy-L-proline;Tripeptide-29/Oligopeptide-29 | | CAS: | 2239-67-0 | | MF: | C12H19N3O5 | | MW: | 285.3 | | EINECS: | 207-843-5 | | Product Categories: | | | Mol File: | 2239-67-0.mol |  |
| | H-Gly-Pro-Hyp-OH Chemical Properties |
| Boiling point | 629.8±55.0 °C(Predicted) | | density | 1.493±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, Sonicated) | | pka | 3.18±0.40(Predicted) | | form | Solid | | color | White to Off-White | | Sequence | Gly-Pro-{Hyp} | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C12H19N3O5/c13-5-10(17)14-3-1-2-8(14)11(18)15-6-7(16)4-9(15)12(19)20/h7-9,16H,1-6,13H2,(H,19,20)/t7-,8+,9+/m1/s1 | | InChIKey | SZEOBSAZWJLOGY-VGMNWLOBSA-N | | SMILES | C(O)(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H]1CCCN1C(=O)CN |
| | H-Gly-Pro-Hyp-OH Usage And Synthesis |
| Purity | ≥98% | | Description | H-Gly-Pro-Hyp-OH (Tripeptide 29) is an orally active bioactive peptide against UVB-induced skin aging and has been reported used as a cosmetic ingredient. | | Uses | H-Gly-Pro-Hyp-OH is a bioactive peptide that plays roles in various physiological functions. A peptidic inhibitor of dipeptidylpeptidase-IV (DPP-IV) | | Definition | ChEBI: Glycylprolylhydroxyproline is an oligopeptide. | | Application |
H-GLY-PRO-HYP-OH is used as ingredient in anti-wrinkle cosmetic compositions.
| | General Description | H-GLY-PRO-HYP-OH (CAS 2239-67-0), also known as Tripeptide-29, Glycylprolylhydroxyproline and glycyl-prolyl-hydroxyproline,
is a high-purity, potent collagen-derived anti-photoageing oligopeptide suitable for research into skin photoageing, UVB-induced skin ageing/photoageing and thrombosis. Furthermore, it can be used in the preparation of biomimetic collagen, cosmetics, pharmaceuticals and tissue engineering materials, amongst other applications. |
| | H-Gly-Pro-Hyp-OH Preparation Products And Raw materials |
|