| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-Azidoaniline hydrochloride manufacturers
|
| | 4-Azidoaniline hydrochloride Basic information |
| | 4-Azidoaniline hydrochloride Chemical Properties |
| Melting point | 165 °C (dec.)(lit.) | | solubility | methanol: soluble | | BRN | 7942921 | | InChI | 1S/C6H6N4.ClH/c7-5-1-3-6(4-2-5)9-10-8;/h1-4H,7H2;1H | | InChIKey | SDYAJRBHPPWHSF-UHFFFAOYSA-N | | SMILES | Cl.Nc1ccc(cc1)N=[N+]=[N-] |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-36/37/38 | | Safety Statements | 16-26-33-36/37-45 | | RIDADR | UN 2926 4.1/PG 2 | | WGK Germany | 3 | | F | 3-8-10 | | HazardClass | 4.1 | | PackingGroup | III | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Azidoaniline hydrochloride Usage And Synthesis |
| Uses | 4-Azidoaniline hydrochloride is suitable for use in the preparation of photo-reactive polymers, poly(acrylic acid) having encorporated phenylazido groups. It may be used in the preparation of 1-(4-aminophenyl)-1H-[1,2,3]-triazol-4-ylcarbonyl-Phe-Gly-Phe-Gly-OH. It is suitable for use in the synthesis of photo-reactive polysaccharides. | | reaction suitability | reaction type: click chemistry | | Purification Methods | Purify it in EtOAc with dry HCl gas followed by cold dry Et2O. The free base has m 66o(dec) (MeOH) and the picrate has m 64-65o(dec) (MeOH). The IR has max (Nujol) at 2110cm-1 (N3). [Escher et al. Helv Chim Acta 62 1217 1979, Maffei & Rivolta Gazetta Chim Ital 84 750 1954, Beilstein 12 H 772, 12 IV 1741.] |
| | 4-Azidoaniline hydrochloride Preparation Products And Raw materials |
|