| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2-Chlorobutyric acid manufacturers
- 2-chlorobutanoic acid
-
- $30.00
-
2023-07-19
- CAS:4170-24-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 Tons
- 2-Chlorobutyric acid
-
- $7.00
-
2020-02-18
- CAS: 4170-24-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | 2-Chlorobutyric acid Basic information |
| | 2-Chlorobutyric acid Chemical Properties |
| Melting point | 76.2-77 °C | | Boiling point | 90-92 °C12 mm Hg(lit.) | | density | 1.190 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.439 | | Fp | 112°C | | Water Solubility | Soluble in water | | form | clear liquid | | pka | 2.86(at RT℃) | | color | Colorless to Light orange to Yellow | | BRN | 1720944 | | InChI | InChI=1S/C4H7ClO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7) | | InChIKey | RVBUZBPJAGZHSQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Cl)CC | | CAS DataBase Reference | 4170-24-5(CAS DataBase Reference) | | NIST Chemistry Reference | Butanoic acid, 2-chloro-(4170-24-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | F | 19 | | HS Code | 2915.90.1800 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Chlorobutyric acid Usage And Synthesis |
| Uses | 2-Chlorobutyric acid was used in the synthesis of 2-hydroxy-5-hexenyl 2-chlorobutyrate ester. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 40, p. 2960, 1975 DOI: 10.1021/jo00908a025 |
| | 2-Chlorobutyric acid Preparation Products And Raw materials |
|