|
|
| | 5-[2-(4'-METHYLBIPHENYL)]TETRAZOLE Basic information |
| | 5-[2-(4'-METHYLBIPHENYL)]TETRAZOLE Chemical Properties |
| Melting point | 150 °C | | Boiling point | 458.4±48.0 °C(Predicted) | | density | 1.216±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.17±0.10(Predicted) | | color | Off-White to Pale Beige | | Major Application | pharmaceutical | | InChI | InChI=1S/C14H12N4/c1-10-6-8-11(9-7-10)12-4-2-3-5-13(12)14-15-17-18-16-14/h2-9H,1H3,(H,15,16,17,18) | | InChIKey | VWOJMXKARYCRCC-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2C2=CC=C(C)C=C2)N=NN1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-[2-(4'-METHYLBIPHENYL)]TETRAZOLE Usage And Synthesis |
| Chemical Properties | Off-White to Pale Beige Solid | | Uses | Valsartan (V095750) impurity. |
| | 5-[2-(4'-METHYLBIPHENYL)]TETRAZOLE Preparation Products And Raw materials |
|