|
|
| | 3-(2-Guanidino-thiazol-4-yl-methylthio)-propionitrile Basic information |
| | 3-(2-Guanidino-thiazol-4-yl-methylthio)-propionitrile Chemical Properties |
| Melting point | 128-132 °C(lit.) | | Boiling point | 459.7±55.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 8.51±0.70(Predicted) | | form | Solid | | color | White to Beige | | InChI | 1S/C8H11N5S2/c9-2-1-3-14-4-6-5-15-8(12-6)13-7(10)11/h5H,1,3-4H2,(H4,10,11,12,13) | | InChIKey | FSKYYRZENXOYAP-UHFFFAOYSA-N | | SMILES | N\C(N)=N\c1nc(CSCCC#N)cs1 | | CAS DataBase Reference | 76823-93-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 22-24-37 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 3-(2-Guanidino-thiazol-4-yl-methylthio)-propionitrile Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Famotidine intermediate. |
| | 3-(2-Guanidino-thiazol-4-yl-methylthio)-propionitrile Preparation Products And Raw materials |
|