|
|
| | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide Basic information |
| Product Name: | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide | | Synonyms: | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide;Bis[(2-guanidino-4-thiazolyl)Methyl]disulfide
(FaMotidine IMpurity);Famotidine Related Compound E (25 mg) (2,2'-[4,4'-disulfanediylbis(methylene)bis(thiazole-4,2-diyl)]diguanidine);N,N'''-[Dithiobis(Methylene-4,2-thiazolediyl)]bisguanidine;Bis[(2-guanidino-4-thiazolyl)Methyl]disulfide (85%)
(FaMotidine IMpurity);2-[4-[[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methyldisulfanyl]methyl]-1,3-thiazol-2-yl]guanidine;2,2'-[Disulfanediylbis-(methylenethiazole-4,2-diyl)]diguanidine;Famotidine USP Related Compound E | | CAS: | 129083-44-9 | | MF: | C10H14N8S4 | | MW: | 374.54 | | EINECS: | | | Product Categories: | Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds;Sulfur & Selenium Compounds;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 129083-44-9.mol | ![Bis[(2-guanidino-4-thiazolyl)methyl]disulfide Structure](CAS2/GIF/129083-44-9.gif) |
| | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide Chemical Properties |
| Melting point | 155-157°C | | Boiling point | 601.0±65.0 °C(Predicted) | | density | 1.86±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMF (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 8.77±0.70(Predicted) | | color | Off-White to Pale Beige | | biological source | synthetic | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C10H14N8S4/c1-21-3-5(15-9(21)17-7(11)12)19-20-6-4-22(2)10(16-6)18-8(13)14/h3-4H,1-2H2,(H4,11,12,15,17)(H4,13,14,16,18) | | InChIKey | UDPYMFXUBRDIAY-UHFFFAOYSA-N | | SMILES | S(C1=CS(=C)C(NC(=N)N)=N1)SC1=CS(=C)C(NC(=N)N)=N1 |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide Usage And Synthesis |
| Uses | A potential impurity in Famotidine (F102250) |
| | Bis[(2-guanidino-4-thiazolyl)methyl]disulfide Preparation Products And Raw materials |
|