|
|
| | 1H-Indazole-1-carboxylic acid, 7-aMino-, 1,1-diMethylethyl ester Basic information |
| | 1H-Indazole-1-carboxylic acid, 7-aMino-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 395.3±34.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.95±0.10(Predicted) | | form | solid | | Appearance | Yellow to orange Solid | | InChI | 1S/C12H15N3O2/c1-12(2,3)17-11(16)15-10-8(7-14-15)5-4-6-9(10)13/h4-7H,13H2,1-3H3 | | InChIKey | HNOIGXWKRHPKMS-UHFFFAOYSA-N | | SMILES | NC1=C2C(C=NN2C(OC(C)(C)C)=O)=CC=C1 |
| HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1H-Indazole-1-carboxylic acid, 7-aMino-, 1,1-diMethylethyl ester Usage And Synthesis |
| | 1H-Indazole-1-carboxylic acid, 7-aMino-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|