|
|
| | Morpholine, 2,6-diMethyl-, (2R,6R)- Basic information |
| Product Name: | Morpholine, 2,6-diMethyl-, (2R,6R)- | | Synonyms: | Morpholine, 2,6-diMethyl-, (2R,6R)-;(2R-trans)-2,6-Dimethylmorpholine;Trans (2S,6S)-2,6-diMethyl Morpholine;(2R,6R)-2,6-Dimethylmorphline;(2R,6R)-2,6-Dimethylmorpholin;(2R,6R)-2,6-Dimethylmorphline 97%;2R,6R-Dimethyl Morpholine;(2R,6R)-2,6-Dimethylmorpholine - [D89098] | | CAS: | 171753-74-5 | | MF: | C6H13NO | | MW: | 115.17 | | EINECS: | | | Product Categories: | | | Mol File: | 171753-74-5.mol |  |
| | Morpholine, 2,6-diMethyl-, (2R,6R)- Chemical Properties |
| Boiling point | 147℃ | | density | 0.862 | | Fp | 49℃ | | storage temp. | 2-8°C | | pka | 9.04±0.60(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/t5-,6-/m1/s1 | | InChIKey | HNVIQLPOGUDBSU-PHDIDXHHSA-N | | SMILES | N1C[C@@H](C)O[C@H](C)C1 |
| | Morpholine, 2,6-diMethyl-, (2R,6R)- Usage And Synthesis |
| Uses | Morpholine, 2,6-diMethyl-, (2R,6R)- is an isomerizing agent that converts (2S,6S)-2,6-dimethylmorpholine to (2R,6R)-2,6-dimethylmorpholine. | | Synthesis | Morpholine, 2,6-diMethyl-, (2R,6R)- was prepared efficiently by O-alkylation of (R)-ethyl lactate with the O-trifluoromethylsulphonyl derivative of (S)-ethyl lactate[1]. | | References | [1] Licandro, E., Maiorana, S., Papagni, A., Pryce, M., Gerosa, A. Z., & Riva, S. (1995). Asymmetric synthesis of (−)-(2R, 6R)-2,6-dimethylmorpholine. Tetrahedron Asymmetry, 6(8), 1891–1894. https://doi.org/10.1016/0957-4166(95)00245-k
|
| | Morpholine, 2,6-diMethyl-, (2R,6R)- Preparation Products And Raw materials |
|