| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
|
| | Diethyl(4-aminophenyl)phosphonate Basic information |
| Product Name: | Diethyl(4-aminophenyl)phosphonate | | Synonyms: | CHEMPACIFIC 60129;(4-AMINO-PHENYL)-PHOSPHONIC ACID DIETHYL ESTER;Diethyl(4-aminophenyl)phosphonate, min. 95 %;4-(Diethoxyphosphoryl)aniline, 4-(Diethylphosphono)aniline;Diethyl (4-aminophenyl)phosphonate 95%;Diethyl(4-aminophenyl)phosphonate95%;Diethyl (4-aminophenyl);(p-Aminophenyl)phosphonic acid diethyl ester | | CAS: | 42822-57-1 | | MF: | C10H16NO3P | | MW: | 229.21 | | EINECS: | | | Product Categories: | | | Mol File: | 42822-57-1.mol |  |
| | Diethyl(4-aminophenyl)phosphonate Chemical Properties |
| Melting point | 47-50 °C | | Boiling point | 341.6±25.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.51±0.10(Predicted) | | Appearance | Yellow to brown Solid | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C10H16NO3P/c1-3-13-15(12,14-4-2)10-7-5-9(11)6-8-10/h5-8H,3-4,11H2,1-2H3 | | InChIKey | OIGQTUBEBRLSOX-UHFFFAOYSA-N | | SMILES | P(C1=CC=C(N)C=C1)(=O)(OCC)OCC |
| Hazard Codes | Xi | | Hazard Note | Irritant/Moisture Sensitive | | HS Code | 2931499090 |
| | Diethyl(4-aminophenyl)phosphonate Usage And Synthesis |
| | Diethyl(4-aminophenyl)phosphonate Preparation Products And Raw materials |
|