| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Diethyl phenylphosphonate Basic information |
| Product Name: | Diethyl phenylphosphonate | | Synonyms: | PHENYLPHOSPHONIC ACID DIETHYL ESTER;phenyl-phosphonicacidiethylester;DIETHYL BENZENEPHOSPHONATE;BENZENEPHOSPHONIC ACID DIETHYL ESTER;AURORA KA-1484;Diethoxyphosphinylbenzene;Phenylphosphonic acid diethyl;TA03770000 | | CAS: | 1754-49-0 | | MF: | C10H15O3P | | MW: | 214.2 | | EINECS: | 217-129-5 | | Product Categories: | | | Mol File: | 1754-49-0.mol |  |
| | Diethyl phenylphosphonate Chemical Properties |
| Boiling point | 110-112°C 1mm | | density | 1,12 g/cm3 | | refractive index | 1.4940 | | Fp | 267°C | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | <0.2g/L(25 ºC) | | BRN | 2449931 | | InChI | InChI=1S/C10H15O3P/c1-3-12-14(11,13-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 | | InChIKey | VZEGPPPCKHRYGO-UHFFFAOYSA-N | | SMILES | C1=CC=C(P(=O)(OCC)OCC)C=C1 | | CAS DataBase Reference | 1754-49-0(CAS DataBase Reference) |
| Risk Statements | 22 | | Safety Statements | 23-36/37-60-36 | | RIDADR | 2810 | | RTECS | TA0377000 | | PackingGroup | III | | HS Code | 29319090 | | Toxicity | mouse,LD50,intraperitoneal,790mg/kg (790mg/kg),Farmakologiya i Toksikologiya Vol. 10, Pg. 121, 1975. |
| Provider | Language |
|
ALFA
| English |
| | Diethyl phenylphosphonate Usage And Synthesis |
| Uses | Diethyl phenylphosphonate is a liquid that can be used as an organophosphine ligand in organic synthesis. | | Synthesis Reference(s) | Journal of the American Chemical Society, 69, p. 2020, 1947 DOI: 10.1021/ja01200a059 The Journal of Organic Chemistry, 39, p. 3612, 1974 DOI: 10.1021/jo00938a045 | | Synthesis | A dried 25 mL flask was charge with triethyl phosphite (11.0 mmol, 1.27 mL) and benzoyl chloride (10.0 mmol, 1.72 mL). After the mixture was stirred for 12 h at room temperature, the crude product was purified by column chromatography over silica gel (300–400 mesh) using CH2Cl2 as an eluent to give analytically pure product Diethyl Phenylphosphonate. |
| | Diethyl phenylphosphonate Preparation Products And Raw materials |
|