- Lauroyl Glutamic Acid
-
-
2026-09-15
- CAS:3397-65-7
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | N-Lauroyl-L-glutamic acid Basic information |
| Product Name: | N-Lauroyl-L-glutamic acid | | Synonyms: | L-Glutamicacid,N-(1-oxododecyl)-(9CI);N-(1-OXODODECYL)GLUTAMICACID;N-Dodecylglutamic acid;N-Lauroylglutamic acid;(S)-2-dodecanamidopentanedioic acid;N-(1-oxododecyl)-L-glutamic acid;Hot sell High quality;SOFTAN LG-A | | CAS: | 3397-65-7 | | MF: | C17H31NO5 | | MW: | 329.43 | | EINECS: | 222-261-1 | | Product Categories: | | | Mol File: | 3397-65-7.mol |  |
| | N-Lauroyl-L-glutamic acid Chemical Properties |
| Melting point | 95-96 °C | | Boiling point | 543.6±40.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Base (Slightly), Chloroform (Slightly) | | form | Solid | | pka | 3.46±0.10(Predicted) | | color | White to Off-White | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | Cosmetic Ingredient Review (CIR) | N-LAUROYL-L-GLUTAMIC ACID (3397-65-7) | | InChI | InChI=1S/C17H31NO5/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23)/t14-/m0/s1 | | InChIKey | AVBJHQDHVYGQLS-AWEZNQCLSA-N | | SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)CCCCCCCCCCC | | LogP | 2.964 (est) | | EPA Substance Registry System | L-Glutamic acid, N-(1-oxododecyl)- (3397-65-7) |
| TSCA | TSCA listed | | HazardClass | IRRITANT |
| | N-Lauroyl-L-glutamic acid Usage And Synthesis |
| Uses | N-Lauroyl-L-glutamic Acid is used in preparation method thereof and application in degrdation of formaldehyde. | | Synthesis | Methyl laurate and monosodium glutamate were used as raw materials and mixed in a molar ratio of 1.8:0.7. Potassium oxide and magnesium oxide were added as metal oxide catalysts, and the amount of catalyst added was 0.05% of the total weight of the reactants. The reaction was carried out according to the one-step synthesis method of Example 1. In the primary mixer, the reaction temperature is controlled at 20 to 30°C, in particular, the mixer inlet temperature is controlled at 25°C, and the mixer outlet temperature is controlled at 25°C; the pH of the reaction system is maintained at 10. In the secondary mixer, the reaction temperature is controlled at 30 to 40°C, in particular, the secondary mixing inlet temperature is controlled at 35°C, and the outlet temperature of both mixers is controlled at 35°C ; the pH of the reaction system was maintained at 13. Upon completion of the reaction, 0.069% of the methanol by-product was obtained by separation, resulting in lauroyl glutamic acid with 88.67% active sodium content and 98% purity. | | References | [1] Patent: CN107353223, 2017, A. Location in patent: Paragraph 0028; 0029; 0030 |
| | N-Lauroyl-L-glutamic acid Preparation Products And Raw materials |
|