- Uprosertib
-
- $39.00
-
2026-07-27
- CAS:1047634-65-0
- Purity: 99.32%
- Supply Ability: 10g
|
| | GSK2141795 Basic information |
| Product Name: | GSK2141795 | | Synonyms: | GSK2141795;Uprosertib(GSK2141795);Uprosertib , GSK2141795C;GSK 2141795C;N-[(1S)-2-Amino-1-[(3,4-difluorophenyl)methyl]ethyl]-5-chloro-4-(4-chloro-1-methyl-1H-pyrazol-5-yl)-2-furancarboxamide;Uprosertib, 98%, a potent and selective pan-Akt inhibitor;CS-1304;Uprosertib (GSK-2141795,GSK795) | | CAS: | 1047634-65-0 | | MF: | C18H16Cl2F2N4O2 | | MW: | 429.25 | | EINECS: | | | Product Categories: | API | | Mol File: | 1047634-65-0.mol |  |
| | GSK2141795 Chemical Properties |
| Boiling point | 543.066±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.527±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:45.33(Max Conc. mg/mL);105.6(Max Conc. mM)
DMF:1.0(Max Conc. mg/mL);2.33(Max Conc. mM)
Ethanol:85.0(Max Conc. mg/mL);198.02(Max Conc. mM) | | form | Powder | | pka | 12.714±0.46(predicted) | | color | White to off-white | | InChI | InChI=1S/C18H16Cl2F2N4O2/c1-26-16(12(19)8-24-26)11-6-15(28-17(11)20)18(27)25-10(7-23)4-9-2-3-13(21)14(22)5-9/h2-3,5-6,8,10H,4,7,23H2,1H3,(H,25,27)/t10-/m0/s1 | | InChIKey | AXTAPYRUEKNRBA-JTQLQIEISA-N | | SMILES | O1C(Cl)=C(C2N(C)N=CC=2Cl)C=C1C(N[C@@H](CC1=CC=C(F)C(F)=C1)CN)=O |
| | GSK2141795 Usage And Synthesis |
| Uses | Uprosertib is a potent and selective inhibitor of pan-Akt (1). Serine/threonine protein kinases, such as Akt, play important roles in cellular activities including cell survival and apoptosis. | | IC 50 | Akt3: 38 nM (IC50); Akt1: 180 nM (IC50); Akt2: 328 nM (IC50); ROCK1: 1570 nM (IC50); ROCK2: 1850 nM (IC50); CDK7: 2100 nM (IC50) |
| | GSK2141795 Preparation Products And Raw materials |
|