|
|
| | L-Tyrosine-2,6-d2 Basic information |
| Product Name: | L-Tyrosine-2,6-d2 | | Synonyms: | L-TYROSINE-2,6-D2, 98 ATOM % D;l-4-hydroxyphenyl-2,6-d2-alanine;l-tyrosine-d2(phenyl-2,6-d2);L-4-Hydroxyphenyl-d2-alanine;L-Tyrosine-2,6-d2;L-4-Hydroxyphenyl-2,6-D2-Alanine (Standard);L-Tyrosine-2,6-d2 | | CAS: | 57746-15-3 | | MF: | C9H9D2NO3 | | MW: | 183.2 | | EINECS: | | | Product Categories: | | | Mol File: | 57746-15-3.mol |  |
| | L-Tyrosine-2,6-d2 Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | Boiling point | 385.163±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 2.254±0.10(predicted) | | form | solid | | Optical Rotation | [α]25/D -12°, c =1 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D | | InChIKey | OUYCCCASQSFEME-RANRWVQCSA-N | | SMILES | [2H]c1cc(O)cc([2H])c1C[C@H](N)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Tyrosine-2,6-d2 Usage And Synthesis |
| Uses | L-4-Hydroxyphenyl-2,6-d2-alanine (CAS# 57746-15-3) is a useful isotopically labeled research compound. |
| | L-Tyrosine-2,6-d2 Preparation Products And Raw materials |
|