- COOH-PEG3-COOtBu
-
-
2025-06-07
- CAS:1807539-06-5
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Acid-PEG3-t-butyl ester Basic information |
| Product Name: | Acid-PEG3-t-butyl ester | | Synonyms: | COOH-PEG3-OtBu;Acid-PEG3-t-butyl ester;4,7,10,14-Tetraoxahexadecanoic acid, 15,15-dimethyl-13-oxo-;HOOCCH2CH2O-PEG2-CH2CH2COOtBu;Acid-PEG3-t-Bu Ester;HOOCCH2CH2O-PEG2-CH2CH2COOtBu/4,7,10,14-Tetraoxahexadecanoic acid, 15,15-dimethyl-13-oxo-;Carboxy-PEG3-tert-butyl Ester;3-[2-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]ethoxy]propanoic acid | | CAS: | 1807539-06-5 | | MF: | C14H26O7 | | MW: | 306.35 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1807539-06-5.mol |  |
| | Acid-PEG3-t-butyl ester Chemical Properties |
| Boiling point | 423.2±35.0 °C(Predicted) | | density | 1.106±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C14H26O7/c1-14(2,3)21-13(17)5-7-19-9-11-20-10-8-18-6-4-12(15)16/h4-11H2,1-3H3,(H,15,16) | | InChIKey | VDWZJPCGUNJFEE-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCC(=O)OC(C)(C)C |
| | Acid-PEG3-t-butyl ester Usage And Synthesis |
| Description | Acid-PEG3-t-butyl ester is a PEG linker containing a t-butyl protected carboxyl group with a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | Acid-PEG3-C2-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs for the degradation of EGFR and inhibition of mTOR[1][2]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] Nathanael Gray, et al. Bifunctional molecules for degradation of egfr and methods of use. WO2017185036A1.
[2] Christopher Semko, et al. Rapamycin analogs as mtor inhibitors. WO 2018204416 A1. |
| | Acid-PEG3-t-butyl ester Preparation Products And Raw materials |
|