- D-(+)-Talose
-
-
2026-08-21
- CAS:2595-98-4
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- D-TALOSE
-
-
2026-07-08
- CAS:2595-98-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kg
- D-TALOSE
-
- $1.00
-
2019-07-14
- CAS:2595-98-4
- Min. Order: 1KG
- Purity: 90%-99.9%
- Supply Ability: 500kg
|
| | D-TALOSE Basic information |
| | D-TALOSE Chemical Properties |
| Melting point | 124-127 °C | | Boiling point | 232.96°C (rough estimate) | | density | 1.581 | | refractive index | 22 ° (C=1, H2O) | | storage temp. | Room Temperature | | solubility | H2O: 0.1 g/mL, clear, colorless | | pka | 12.45±0.20(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]20/D +21±1°, 3 hr, c = 1% in H2O | | BRN | 1724617 | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5+,6/m1/s1 | | InChIKey | WQZGKKKJIJFFOK-WHZQZERISA-N | | SMILES | OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@H]1O | | LogP | -3.170 (est) | | CAS DataBase Reference | 2595-98-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2940000080 | | Storage Class | 11 - Combustible Solids |
| | D-TALOSE Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | D-Talose is a monosaccharide sugar that can convert between aldose and ketose forms in pyridine in the presence of aluminum oxide. | | Definition | ChEBI: Aldehydo-D-talose is d-Talose in its acyclic form. |
| | D-TALOSE Preparation Products And Raw materials |
|