| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Carbobenzyloxy-L-aspartic anhydride Basic information |
| | N-Carbobenzyloxy-L-aspartic anhydride Chemical Properties |
| Melting point | 123-124 °C(lit.) | | Boiling point | 490℃ | | density | 1.37 | | Fp | 250℃ | | storage temp. | 2-8°C | | form | powder | | pka | 9.93±0.20(Predicted) | | Optical Rotation | [α]20/D 25°, c = 1 in methanol | | Major Application | peptide synthesis | | InChI | 1S/C12H11NO5/c14-10-6-9(11(15)18-10)13-12(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16)/t9-/m0/s1 | | InChIKey | OZPYEGOBGWQOSZ-VIFPVBQESA-N | | SMILES | O=C1C[C@H](NC(=O)OCc2ccccc2)C(=O)O1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-Carbobenzyloxy-L-aspartic anhydride Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Carbobenzyloxy-L-aspartic anhydride Preparation Products And Raw materials |
|