| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Tetraheptylammonium iodide manufacturers
|
| | Tetraheptylammonium iodide Basic information |
| Product Name: | Tetraheptylammonium iodide | | Synonyms: | TETRA-N-HEPTYLAMMONIUM IODIDE;1-Heptanaminium, N,N,N-triheptyl-, iodide;Ammonium, tetraheptyl-, iodide;n,n,n-triheptyl-1-heptanaminiuiodide;N,N,N-triheptyl-1-heptanaminiumiodide;Tetra-n-heptylammoniumiodide,99%;Tetraheptylammonium iodide,99%;Tatre-n-heptylammonium Iodide | | CAS: | 3535-83-9 | | MF: | C28H60IN | | MW: | 537.69 | | EINECS: | 222-570-1 | | Product Categories: | Ammonium Iodides (Quaternary);Quaternary Ammonium Compounds | | Mol File: | 3535-83-9.mol |  |
| | Tetraheptylammonium iodide Chemical Properties |
| Melting point | 122-126 °C | | density | 1.0208 (estimate) | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Almost white | | Sensitive | Hygroscopic | | BRN | 4167115 | | InChI | 1S/C28H60N.HI/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;/h5-28H2,1-4H3;1H/q+1;/p-1 | | InChIKey | KCSOHLKZTZMKQA-UHFFFAOYSA-M | | SMILES | [I-].[N+](CCCCCCC)(CCCCCCC)(CCCCCCC)CCCCCCC | | CAS DataBase Reference | 3535-83-9(CAS DataBase Reference) | | EPA Substance Registry System | 1-Heptanaminium, N,N,N-triheptyl-, iodide (3535-83-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetraheptylammonium iodide Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Tetraheptylammonium iodide (CAS# 3535-83-9) is a compound used in electrolyte solutions for dye-sensitized solar cells. | | Purification Methods | Crystallise the iodide from EtOH or aqueous EtOH. [Eriksen et al. J Org Chem 25 849 1960, Beilstein 4 IV 736 for triheptylamine.] |
| | Tetraheptylammonium iodide Preparation Products And Raw materials |
|