|
|
| | Tetrapropylammonium iodide Basic information | | Uses |
| | Tetrapropylammonium iodide Chemical Properties |
| Melting point | 280-285 °C (dec.) (lit.) | | density | 1,313 g/cm3 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | SOLUBLE | | Sensitive | Hygroscopic | | BRN | 3567386 | | InChI | 1S/C12H28N.HI/c1-5-9-13(10-6-2,11-7-3)12-8-4;/h5-12H2,1-4H3;1H/q+1;/p-1 | | InChIKey | GKXDJYKZFZVASJ-UHFFFAOYSA-M | | SMILES | [I-].CCC[N+](CCC)(CCC)CCC | | CAS DataBase Reference | 631-40-3(CAS DataBase Reference) | | EPA Substance Registry System | Tetrapropylammonium iodide (631-40-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | BS8410000 | | F | 8 | | TSCA | TSCA listed | | HS Code | 29239000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Tetrapropylammonium iodide Usage And Synthesis |
| Uses | DADLE is a selective δ-OR agonist. | | Chemical Properties | white to slightly yellow crystalline powder or | | Uses | Tetrapropylammonium iodide is an organic compound commonly used as ionic liquids and catalysts. It can be used as a solvent in some chemical reactions, and can also be used as a catalyst to promote some organic synthesis reactions. In addition, the compound is also widely used in batteries, solar cells and pigments. | | Purification Methods | Purify the iodide by crystallising it from EtOH, EtOH/diethyl ether (1:1), EtOH/water or aqueous acetone. Dry it at 50o under a vacuum and store it over P2O5 in a vacuum desiccator. Keep it away from light. [Beilstein 4 IV 472.] |
| | Tetrapropylammonium iodide Preparation Products And Raw materials |
|