| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Barium trifluoromethanesulfonate Basic information |
| Product Name: | Barium trifluoromethanesulfonate | | Synonyms: | trifluoro-methanesulfonicacibariumsalt;barium trifluoromethanesulphonate;TRIFLUOROMETHANESULFONIC ACID BARIUM;BARIUM TRIFLUOROMETHANESULFONATE, 99% (BARIUM TRIFLATE);Trifluoromethanesulfonic acid barium salt;Barium triflate, Trifluoromethanesulfonic acid barium salt;Bis(trifluoromethanesulfonic acid)barium salt;Barium trifluoromethanesulfonate,98% | | CAS: | 2794-60-7 | | MF: | C2BaF6O6S2 | | MW: | 435.47 | | EINECS: | 220-526-6 | | Product Categories: | OTf&NTf series;Other Metal;triflate;metal triflate compounds | | Mol File: | 2794-60-7.mol |  |
| | Barium trifluoromethanesulfonate Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 5: forms reversible hydrate | | BRN | 3729346 | | Exposure limits | ACGIH: TWA 0.5 mg/m3
NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 | | Stability: | hygroscopic | | InChI | InChI=1S/2CHF3O3S.Ba/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 | | InChIKey | DXJURUJRANOYMX-UHFFFAOYSA-L | | SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Ba+2] | | EPA Substance Registry System | Methanesulfonic acid, trifluoro-, barium salt (2794-60-7) |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | RIDADR | UN 1564 6.1/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049020 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | Barium trifluoromethanesulfonate Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Ba(CF3SO3) can be utilized as a precursor to synthesize:
- Alkali metal and silver trifluoromethanesulfonates.
- Sodium trifluoromethanesulfonate (sodium triflate) by reacting with sodium sulfate. Sodium triflate finds application in organic synthesis as an efficient catalyst as well as a reactant in catalytic asymmetric Mannich-type reactions, and Diels-Alder reactions.
|
| | Barium trifluoromethanesulfonate Preparation Products And Raw materials |
|