|
|
| | Diphenylacetylene-d 10 Basic information |
| | Diphenylacetylene-d 10 Chemical Properties |
| Melting point | 58-60 °C(lit.) | | Boiling point | 170 °C19 mm Hg(lit.) | | density | 1.045 g/mL at 25 °C(lit.) | | Major Application | electronics | | InChI | 1S/C14H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D | | InChIKey | JRXXLCKWQFKACW-LHNTUAQVSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C#Cc2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Diphenylacetylene-d 10 Usage And Synthesis |
| Uses | Tolan-d10 (CAS# 19339-46-9) is a useful isotopically labeled research compound. |
| | Diphenylacetylene-d 10 Preparation Products And Raw materials |
|