| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-Hydroxyestrone manufacturers
- 4-HYDROXYESTRONE
-
- $1.00
-
2024-07-07
- CAS:3131-23-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 4-Hydroxyestrone Basic information |
| Product Name: | 4-Hydroxyestrone | | Synonyms: | 1,3,5[10]-ESTRATRIENE-3,4-DIOL-17-ONE;1,3,5(10)-ESTRATRIEN-3,4-DIOL-17-ONE;3,4-DIHYDROXY-1,3,5[10]-ESTRATRIEN-17-ONE;3,4-dihydroxyestra-1,3,5(10)-trien-17-one;5(10)-trien-17-one,3,4-dihydroxy-estra-3;(9S,14S)-3,4-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;Estrone 4-Hydroxy Impurity;3,4-Dihydroxy-1(10),2,4-estratriene-17-one | | CAS: | 3131-23-5 | | MF: | C18H22O3 | | MW: | 286.37 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids | | Mol File: | 3131-23-5.mol |  |
| | 4-Hydroxyestrone Chemical Properties |
| Melting point | 260-263°C | | Boiling point | 468.2±45.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | Fp | 93 °C | | storage temp. | −20°C | | solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | pka | 10.06±0.40(Predicted) | | color | Pale Yellow to Light Brown | | InChI | 1S/C18H22O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,19,21H,2-3,5,7-9H2,1H3/t11-,12-,14+,18+/m1/s1 | | InChIKey | XQZVQQZZOVBNLU-QDTBLXIISA-N | | SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])CCc4c(O)c(O)ccc24 |
| WGK Germany | 3 | | RTECS | KG7749500 | | Storage Class | 11 - Combustible Solids |
| | 4-Hydroxyestrone Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Estradiol. | | Definition | ChEBI: A 4-hydroxy steroid that is estrone substituted by a hydroxy group at position 4. | | Hazard | A reproductive hazard. | | Biochem/physiol Actions | 4-Hydroxyestrone is an endogenous estrogen metabolite, which exhibits a strong neuroprotective effect against oxidative damage. It also provides effective protection against kanic acid-induced hippocampal oxidative damage in rats when compared to 17β-estradiol. 4-Hydroxyestrone regulates the angiogenic process during corpus luteum formation. It might be involved in an increased risk of cancer. 4-Hydroxyestrone is found in the early and mid-luteal phases. |
| | 4-Hydroxyestrone Preparation Products And Raw materials |
|