2-Hydroxyestrone manufacturers
- 2-HYDROXYESTRONE
-
- $1.00
-
2024-06-18
- CAS:362-06-1
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100G
|
| | 2-Hydroxyestrone Basic information |
| Product Name: | 2-Hydroxyestrone | | Synonyms: | 2,3-Dihydroxy-1(10),2,4-estratriene-17-one;2,3-Dihydroxy-1(10),2,4-est;2,3-DIHYDROXY-1,3,5[10]-ESTRATRIEN-17-ONE;1,3,5(10)-ESTRATRIEN-2,3-DIOL-17-ONE;1,3,5[10]-ESTRATRIENE-2,3-DIOL-17-ONE;2,3-dihydroxy-estra-1,3,5(10)-trien-17-one;1,3,5(10)Estatrien-2,3-diol-17-one;Catecholestrone | | CAS: | 362-06-1 | | MF: | C18H22O3 | | MW: | 286.37 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids | | Mol File: | 362-06-1.mol |  |
| | 2-Hydroxyestrone Chemical Properties |
| Melting point | 199-201°C | | Boiling point | 481.3±45.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.10±0.40(Predicted) | | color | Off-White to Light Brown | | biological source | synthetic | | InChI | 1S/C18H22O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,19-20H,2-7H2,1H3/t11-,12+,14-,18-/m0/s1 | | InChIKey | SWINWPBPEKHUOD-JPVZDGGYSA-N | | SMILES | Oc1cc2c(cc1O)CC[C@H]3[C@H]4[C@](CC[C@@H]32)(C(=O)CC4)C |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | 2-Hydroxyestrone Usage And Synthesis |
| Chemical Properties | Off-White to Tan Solid | | Uses | A metabolite of Estradiol. | | Definition | ChEBI: A 2-hydroxy steroid that is estrone substituted by a hydroxy group at position 2. | | in vivo | Levels of both 2-Hydroxyestrone (2-OHE1; 2 mg/kg; administered ip.) and 2-Hydroxyestrone 4-N-acetylcysteine thioether (2-OHE1 4SR) in rats treated with 2-Hydroxyestrone were significantly different between the induced and noninduced groups[3]. | Animal Model: | Female and male Sprague-Dawley rats (6 weeks old)[3] | | Dosage: | 2 mg/kg
| | Administration: | Administered i.p.
| | Result: | Levels of both 2-OHE1and 2-OHE14SR in rats treated with 2-OHE1were significantly different between the induced and noninduced groups.
|
| | IC 50 | Human Endogenous Metabolite; Estrogen receptor |
| | 2-Hydroxyestrone Preparation Products And Raw materials |
|