| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
- 2-Methoxyestrone
-
- $42.00
-
2026-07-14
- CAS:362-08-3
- Purity: 99.51%
- Supply Ability: 10g
- 2-Methoxyestrone
-
- $42.00
-
2026-07-13
- CAS:362-08-3
- Purity: 99.51%
- Supply Ability: 10g
- 2-METHOXYESTRONE
-
- $1.00
-
2024-06-18
- CAS:362-08-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 200G
|
| | 2-Methoxyestrone Basic information |
| Product Name: | 2-Methoxyestrone | | Synonyms: | 2,3-DIHYDROXY-1,3,5[10]-ESTRATRIEN-17-ONE 2-METHYL ETHER;2-HYDROXYESTRONE 2-METHYL ETHER;1,3,5(10)-ESTRATRIEN-2,3-DIOL-17-ONE 2-METHYL ETHER;3-HYDROXY-2-METHOXY-1,3,5[10]-ESTRATRIEN-17-ONE;DL-2-METHOXYESTRONE;Estrone 2-Methoxy Impurity;3-hydroxy-2-methoxyestra-1,3,5(10)-trien-17-one;3-hydroxy-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one | | CAS: | 362-08-3 | | MF: | C19H24O3 | | MW: | 300.39 | | EINECS: | 206-645-6 | | Product Categories: | Isolabel | | Mol File: | 362-08-3.mol |  |
| | 2-Methoxyestrone Chemical Properties |
| Melting point | 187.0-189.5 °C | | Boiling point | 463.5±45.0 °C(Predicted) | | density | 1.172±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform: slightly soluble | | pka | 10.27±0.40(Predicted) | | form | Solid | | color | White to off-white | | biological source | synthetic | | Optical Rotation | [α]/D +182.5±7.5°, c = 0.5 in methanol | | InChI | 1S/C19H24O3/c1-19-8-7-12-13(15(19)5-6-18(19)21)4-3-11-9-16(20)17(22-2)10-14(11)12/h9-10,12-13,15,20H,3-8H2,1-2H3/t12-,13+,15-,19-/m0/s1 | | InChIKey | WHEUWNKSCXYKBU-QPWUGHHJSA-N | | SMILES | C[C@@]12[C@](CCC2=O)([H])[C@]3([H])CCC4=CC(O)=C(OC)C=C4[C@@]3([H])CC1 |
| Hazard Codes | Xn,N | | Risk Statements | 40-50/53 | | Safety Statements | 22-36-61-60 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 2 |
| | 2-Methoxyestrone Usage And Synthesis |
| Uses | 2-Methoxyestrone is a endogenous estrogen metabolite. 2-Methoxyestrone detection can be used as a breast cancer biomarker and help assess the risk-factors for development of breast cancer. | | Definition | ChEBI: A 17-oxo steroid that is estrone in which the hydrogen at position 2 is substituted by a methoxy group. | | IC 50 | Human Endogenous Metabolite |
| | 2-Methoxyestrone Preparation Products And Raw materials |
|