| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,2-Bis(dimethoxyphosphoryl)benzene Basic information |
| Product Name: | 1,2-Bis(dimethoxyphosphoryl)benzene | | Synonyms: | 1,2-Bis(dimethoxyphosphoryl)benzene,99%;1,2-Bis(dimethoxyphosphoryl)benzene,97%;TETRAMETHYL 1,2-PHENYLENEDIPHOSPHONATE;TETRAMETHYL O-PHENYLENEDIPHOSPHONATE;1,2-BIS(DIMETHOXYPHOSPHORYL)BENZENE 99%;Phosphonic acid, P,P'-1,2-phenylenebis-, P,P,P',P'-tetramethyl ester;Tetramethyl 1,2-phenylenebis(phosphonate);1,2-bis(dimethoxyphosphorusacyl)benzene | | CAS: | 15104-46-8 | | MF: | C10H16O6P2 | | MW: | 294.18 | | EINECS: | | | Product Categories: | Organic Building Blocks;Phosphonates/Phosphinates;Phosphorus Compounds;organophosphorus compound;Building Blocks;Chemical Synthesis;Organic Building Blocks;Phosphorus Compounds | | Mol File: | 15104-46-8.mol |  |
| | 1,2-Bis(dimethoxyphosphoryl)benzene Chemical Properties |
| Melting point | 79-84 °C | | Boiling point | 373.6±25.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | form | crystal | | color | white | | InChI | InChI=1S/C10H16O6P2/c1-13-17(11,14-2)9-7-5-6-8-10(9)18(12,15-3)16-4/h5-8H,1-4H3 | | InChIKey | TUKTVDDATWNXSN-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1P(=O)(OC)OC)P(=O)(OC)OC | | CAS DataBase Reference | 15104-46-8(CAS DataBase Reference) |
| Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 24/25 | | RIDADR | UN3464 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29199000 |
| | 1,2-Bis(dimethoxyphosphoryl)benzene Usage And Synthesis |
| Chemical Properties | SLIGHTLY YELLOW CRYSTALLINE POWDER | | Uses | Tetramethyl-1,2-phenylenediphosphonate is a useful reagent for the synthesis of 1,2-bis(phosphino)benzene and related alkylated species. |
| | 1,2-Bis(dimethoxyphosphoryl)benzene Preparation Products And Raw materials |
|