| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Dimethyl phenylphosphonite Basic information |
| Product Name: | Dimethyl phenylphosphonite | | Synonyms: | DIMETHOXYPHENYLPHOSPHINE;PHENYLPHOSPHOROUS ACID DIMETHYL ESTER;PHENYLDIMETHOXYPHOSPHINE;Dimethyl phenylphosphonite,97%;Phosphonous acid, phenyl-, dimethyl ester;Phosphorus, dimethoxy phenyl;Phenylphosphonous acid dimethyl ester;Dimethyl phenylphosphinite | | CAS: | 2946-61-4 | | MF: | C8H11O2P | | MW: | 170.15 | | EINECS: | 220-960-6 | | Product Categories: | organophosphorus ligand | | Mol File: | 2946-61-4.mol |  |
| | Dimethyl phenylphosphonite Chemical Properties |
| Boiling point | 77-79°C 7mm | | density | 1.072 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.529(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | liquid | | Specific Gravity | 1.072 | | color | colorless | | Water Solubility | Miscible with alcohol. Immiscible with water. | | Sensitive | Air Sensitive | | BRN | 1073018 | | InChI | InChI=1S/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 | | InChIKey | LMZLQYYLELWCCW-UHFFFAOYSA-N | | SMILES | C1=CC=C(P(OC)OC)C=C1 | | CAS DataBase Reference | 2946-61-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1760 8/PG 2 | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | Dimethyl phenylphosphonite Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Dimethyl phenylphosphonite is used in the preparation of phenyl-phosphonic acid dimethyl ester. It is used as a precursor for the preparation of dinitrosyltris(dimethyl phenylphosphonite)manganese(I) tetrafluoroborate. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling |
| | Dimethyl phenylphosphonite Preparation Products And Raw materials |
|