|
|
| | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE Basic information |
| Product Name: | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE | | Synonyms: | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE;1,2-BIS(DIPHENYLPHOSPHINO)BENZENE 98%;o-bis(diphenylphosphino)benzene;o-Phenylenebis[diphenylphosphine];1,2-Bis(diphenylphosphino)benzene,98%;JACS-13991-08-7;Phosphine,1,1'-(1,2-phenylene)bis[1,1-diphenyl-;1,2-Phenylenebis(Diphenylphosphine) | | CAS: | 13991-08-7 | | MF: | C30H24P2 | | MW: | 446.47 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Ligand;Catalysis and Inorganic Chemistry;Phosphorus Compounds;Polydentate Phosphine Ligands;organophosphine ligand | | Mol File: | 13991-08-7.mol |  |
| | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE Chemical Properties |
| Melting point | 183-188 °C (lit.) | | Boiling point | 546.9±33.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Fine Crystalline Powder | | color | White | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C30H24P2/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-24H | | InChIKey | NFRYVRNCDXULEX-UHFFFAOYSA-N | | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1P(C1C=CC=CC=1)C1C=CC=CC=1 | | CAS DataBase Reference | 13991-08-7(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 1,2-Bis(diphenylphosphino)benzene (DPPB) can be used:
- As a chelating ligand in the synthesis of luminescent copper(I) halide complexes.
- In the synthesis of copper-1,2-bis(diphenylphosphino)benzene catalyst which is used for the β-boration of α, β-unsaturated amide.
- As an alternative to TMEDA for the selective cleavage of sp3 C-X bond in fluoroaromatic coupling reactions catalyzed by iron.
- As a ligand in the synthesis of alkenylboronates from acetylenic esters.
- To synthesize copper-diphosphine complexes which are used as homogeneous catalysts for N-formylation of a wide range of amines.
| | Application | 1,2-Bis(diphenylphosphino)benzene is a highly efficient bidentate phosphine ligand. It forms a stable five-membered ring chelate with a single transition metal atom (such as palladium, nickel, rhodium, gold, etc.) through its two adjacent diphenylphosphine groups. This structure gives the catalyst high activity and high stability, so it is widely used in various homogeneous catalytic reactions. | | reaction suitability | reagent type: ligand reaction type: Baeyer-Villiger Oxidation reagent type: ligand reaction type: Cycloadditions reagent type: ligand reaction type: Reductions |
| | 1,2-BIS(DIPHENYLPHOSPHINO)BENZENE Preparation Products And Raw materials |
|