| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 7-Methoxyflavonol Basic information |
| | 7-Methoxyflavonol Chemical Properties |
| Melting point | 177-178°C | | Boiling point | 446.6±45.0 °C(Predicted) | | density | 1.353±0.06 g/cm3(Predicted) | | form | Solid | | pka | 8.67±0.20(Predicted) | | color | White to off-white | | InChI | 1S/C16H12O4/c1-19-11-7-8-12-13(9-11)20-16(15(18)14(12)17)10-5-3-2-4-6-10/h2-9,18H,1H3 | | InChIKey | IPRIGHIBTRMTDP-UHFFFAOYSA-N | | SMILES | COc1ccc2C(=O)C(O)=C(Oc2c1)c3ccccc3 | | LogP | 3.670 (est) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 7-Methoxyflavonol Usage And Synthesis |
| Uses | 7-Methoxyflavonol (cas# 7478-60-6) is a flavenoid which, as a class of compounds, have broad pharmacological activity, including binding to biomolecules such as enzymes, hormone carriers, and DNA, chelating transition metal ions, catalyzing electron transport, and scavenging free radicals. | | Definition | ChEBI: 3-hydroxy-7-methoxyflavone is a hydroxyflavan. |
| | 7-Methoxyflavonol Preparation Products And Raw materials |
|