| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,4-Dichloro-omega-nitrostyrene Basic information |
| | 3,4-Dichloro-omega-nitrostyrene Chemical Properties |
| Melting point | 93-97 °C(lit.) | | Boiling point | 341.242±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.448±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | BRN | 2211292 | | InChI | 1S/C8H5Cl2NO2/c9-7-2-1-6(5-8(7)10)3-4-11(12)13/h1-5H/b4-3+ | | InChIKey | XHGCFWXSHIHYFH-ONEGZZNKSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(Cl)c(Cl)c1 | | CAS DataBase Reference | 18984-16-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,2-dichloro-4-(2-nitroethenyl)- (18984-16-2) |
| Hazard Codes | Xi,N | | Risk Statements | 50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | 3,4-Dichloro-omega-nitrostyrene Usage And Synthesis |
| | 3,4-Dichloro-omega-nitrostyrene Preparation Products And Raw materials |
|