2,4-DICHLORO-OMEGA-NITROSTYRENE manufacturers
|
| | 2,4-DICHLORO-OMEGA-NITROSTYRENE Basic information |
| | 2,4-DICHLORO-OMEGA-NITROSTYRENE Chemical Properties |
| Melting point | 115-119 °C(lit.) | | Boiling point | 334.1±27.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | InChI | 1S/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ | | InChIKey | LIWIJBBAMBDXME-ONEGZZNKSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(Cl)cc1Cl | | CAS DataBase Reference | 18984-21-9(CAS DataBase Reference) |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 22-36-50/53 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2904990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |
| | 2,4-DICHLORO-OMEGA-NITROSTYRENE Usage And Synthesis |
| | 2,4-DICHLORO-OMEGA-NITROSTYRENE Preparation Products And Raw materials |
|