|
|
| | 2-CHLORO-1,3-THIAZOLE-5-CARBOXYLIC ACID Basic information |
| | 2-CHLORO-1,3-THIAZOLE-5-CARBOXYLIC ACID Chemical Properties |
| Melting point | 165.5-167°C | | Boiling point | 370.2±34.0 °C(Predicted) | | density | 1.693±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.52±0.10(Predicted) | | form | claggy powder | | color | peachy | | InChI | InChI=1S/C4H2ClNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8) | | InChIKey | HNJOKQPEJIWTRF-UHFFFAOYSA-N | | SMILES | S1C(C(O)=O)=CN=C1Cl |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | 2-CHLORO-1,3-THIAZOLE-5-CARBOXYLIC ACID Usage And Synthesis |
| Uses | 2-Chloro-5-thiazolecarboxylic Acid-13C3,15N is an isotopically labeled analog of 2-Chloro-5-thiazolecarboxylic Acid (C411465), which was studied as one of the metabolites of thiamethoxam, clothianidin, and dinotefuran in mice. |
| | 2-CHLORO-1,3-THIAZOLE-5-CARBOXYLIC ACID Preparation Products And Raw materials |
|