|
|
| | 2-CHLORO-1,3-THIAZOLE-4-CARBOXYLIC ACID Basic information |
| | 2-CHLORO-1,3-THIAZOLE-4-CARBOXYLIC ACID Chemical Properties |
| Melting point | 220 °C | | Boiling point | 370.2±34.0 °C(Predicted) | | density | 1.693±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline Powder | | pka | 3.15±0.10(Predicted) | | color | White to yellow | | InChI | InChI=1S/C4H2ClNO2S/c5-4-6-2(1-9-4)3(7)8/h1H,(H,7,8) | | InChIKey | UVYJJJQMZPCYKY-UHFFFAOYSA-N | | SMILES | S1C=C(C(O)=O)N=C1Cl |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | 2-CHLORO-1,3-THIAZOLE-4-CARBOXYLIC ACID Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 2-chloro-1,3-thiazole-4-carboxylic acid from ethyl 2-chlorothiazole-4-carboxylate was as follows: 14.0 g (73.1 mmol) of ethyl 2-chlorothiazole-4-carboxylate was slowly added to 11.0 g (0.17 mol, 85% purity) of potassium hydroxide in a solution of ethanol/water (1:3, 200 mL), keeping the reaction temperature at 0 °C. The reaction mixture was stirred at room temperature for 16 hours before being diluted with water and washed twice with ether. Subsequently, the aqueous layer was acidified to pH=5.5 with concentrated hydrochloric acid and stirring was continued at room temperature for three days. The precipitate formed was collected by filtration and dried under vacuum at 40°C to give 7.0 g (56% yield, 95% purity) of 2-chloro-1,3-thiazole-4-carboxylic acid as a brown solid product. | | References | [1] Patent: WO2011/3796, 2011, A1. Location in patent: Page/Page column 126; 127
[2] Helvetica Chimica Acta, 1944, vol. 27, p. 1432,1433
[3] Patent: US5498630, 1996, A
[4] Patent: WO2007/146066, 2007, A2. Location in patent: Page/Page column 152 |
| | 2-CHLORO-1,3-THIAZOLE-4-CARBOXYLIC ACID Preparation Products And Raw materials |
|