| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Nitro-1-naphthylamine Basic information |
| | 4-Nitro-1-naphthylamine Chemical Properties |
| Melting point | 190-193 °C(lit.) | | Boiling point | 419.0±25.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 1.31±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 2211897 | | InChI | 1S/C10H8N2O2/c11-9-5-6-10(12(13)14)8-4-2-1-3-7(8)9/h1-6H,11H2 | | InChIKey | BVPJPRYNQHAOPQ-UHFFFAOYSA-N | | SMILES | Nc1ccc([N+]([O-])=O)c2ccccc12 | | CAS DataBase Reference | 776-34-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Naphthalenamine, 4-nitro-(776-34-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | QM4370000 | | HS Code | 29214500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Nitro-1-naphthylamine Usage And Synthesis |
| Chemical Properties | Orange-yellow needle-shaped crystals. Melting point: 196°C. Soluble in ethanol and acetic acid, slightly soluble in hot water. | | Purification Methods | It crystallises from EtOH, ethyl acetate or aqueous NH3 as light yellow crystals. The acetyl derivative also forms yellow crystals, m 192.5-193.5o, from Me2CO. [Beilstein 12 H 1259, 12 I 530, 12 II 704, 12 III 2971, 12 IV 3114.] |
| | 4-Nitro-1-naphthylamine Preparation Products And Raw materials |
|