|
|
| | TRANS-3-HYDROXY-L-PROLINE Basic information |
| | TRANS-3-HYDROXY-L-PROLINE Chemical Properties |
| Melting point | 235 °C | | Boiling point | 242.42°C (rough estimate) | | density | 1.395 | | refractive index | 1.4300 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | soluble in No data available | | pka | 2.03±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | Optical Rotation | -15.667°(C=0.01g/ml H2O) | | InChI | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 | | InChIKey | BJBUEDPLEOHJGE-IMJSIDKUSA-N | | SMILES | C(O)(=O)[C@@H]1[C@@H](O)CCN1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29339980 |
| | TRANS-3-HYDROXY-L-PROLINE Usage And Synthesis |
| Chemical Properties | White to light beige powder | | Uses | trans-3-Hydroxyproline, is a versatile building block, used in the synthesis of various pharmaceutical and biologically active compounds. It is used as an intermediate in the synthesis of ferrocene-hydroxyproline amino acid conjugates. | | Definition | ChEBI: Trans-3-hydroxy-L-proline is the (3S)-trans-diastereomer of 3-hydroxy-L-proline. It has a role as a metabolite. It is a tautomer of a trans-3-hydroxy-L-proline zwitterion. |
| | TRANS-3-HYDROXY-L-PROLINE Preparation Products And Raw materials |
|