|
|
| | 4-BROMO-2-CHLORO-1-IODOBENZENE Basic information | | Appearance |
| | 4-BROMO-2-CHLORO-1-IODOBENZENE Chemical Properties |
| Melting point | 35 °C | | Boiling point | 103-105°C | | density | 2.272±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.6722 | | Fp | 103-105°C/1mm | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Yellow | | Sensitive | Light Sensitive | | BRN | 2435075 | | InChI | InChI=1S/C6H3BrClI/c7-4-1-2-6(9)5(8)3-4/h1-3H | | InChIKey | OHHKQBZOURGNLR-UHFFFAOYSA-N | | SMILES | C1(I)=CC=C(Br)C=C1Cl | | CAS DataBase Reference | 31928-47-9(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-BROMO-2-CHLORO-1-IODOBENZENE Usage And Synthesis |
| Appearance | 4-Bromo-2-chloro-1-iodobenzene is a white or colorless to yellow powder to lump to clear liquid. | | Uses | 4-Bromo-2-chloro-1-iodobenzene is a hydrocarbon derivative and can be used as an intermediate in organic synthesis. |
| | 4-BROMO-2-CHLORO-1-IODOBENZENE Preparation Products And Raw materials |
|