|
|
| | Diethyl trans-1,2-cyclopropanedicarboxylate Basic information |
| Product Name: | Diethyl trans-1,2-cyclopropanedicarboxylate | | Synonyms: | Diethyl trans-1,2-cyclopropanedicarboxylate 97%;1,2-Cyclopropanedicarboxylicacid, 1,3-diethyl ester, (1R,2R)-rel-;(±)-trans-cyclopropane-1,2-dicarboxylicaciddiethylester;(E)-1,2-CYCLOPROPANEDICARBOXYLIC ACID DIETHYL ESTER;diethyl trans-cyclopropane-1,2-dicarboxylate;Diethyl trans-1,2-cyclopropanedicarboxylate,97%;trans-Diethyl cyclopropane-1,2-dicarboxylate;Diethyl trans-1,2-cyclopropanedicarboxylate, 97% 5GR | | CAS: | 3999-55-1 | | MF: | C9H14O4 | | MW: | 186.21 | | EINECS: | | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 3999-55-1.mol |  |
| | Diethyl trans-1,2-cyclopropanedicarboxylate Chemical Properties |
| Boiling point | 70-75 °C/1 mmHg (lit.) | | density | 1.061 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.441(lit.) | | Fp | 209 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid After Melting | | color | Clear colorless to yellow | | InChI | InChI=1/C9H14O4/c1-3-12-8(10)6-5-7(6)9(11)13-4-2/h6-7H,3-5H2,1-2H3/t6-,7-/s3 | | InChIKey | SXLDHZFJMXLFJU-RNFRBKRXSA-N | | SMILES | [C@@H]1(C(OCC)=O)C[C@H]1C(OCC)=O |&1:0,7,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 10 - Combustible liquids |
| | Diethyl trans-1,2-cyclopropanedicarboxylate Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid after melting | | Uses | Diethyl trans-1,2-cyclopropanedicarboxylate was obtained from the reaction of bis(acetonitrile)bis(diethyl fumarate)cobalt(0) with dibromomethane. | | General Description | Diethyl trans-1,2-cyclopropanedicarboxylate was obtained from the reaction of bis(acetonitrile)bis(diethyl fumarate)cobalt(0) with dibromomethane. |
| | Diethyl trans-1,2-cyclopropanedicarboxylate Preparation Products And Raw materials |
|