|
|
| | ACETIC ANHYDRIDE-D6 Basic information |
| Product Name: | ACETIC ANHYDRIDE-D6 | | Synonyms: | Acetic-d3 acid, anhydride;Acetic anhydride-D6 98.5 atom % D;Bis(2,2,2-2H3)acetic anhydride;Bis[(2,2,2-2H3)acetic acid]anhydride;Di[(2,2,2-2H3)acetic]anhydride;Acetic anhydride-d6,for NMR,98.5 atom % D;<2H6>-acetic anhydride;ACETIC ANHYDRIDE-D6 | | CAS: | 16649-49-3 | | MF: | C4D6O3 | | MW: | 108.13 | | EINECS: | 240-697-0 | | Product Categories: | Alphabetical Listings;Stable Isotopes;A | | Mol File: | 16649-49-3.mol |  |
| | ACETIC ANHYDRIDE-D6 Chemical Properties |
| Melting point | -73 °C(lit.) | | Boiling point | 138-140 °C(lit.) | | density | 1.143 g/mL at 25 °C | | refractive index | n20/D 1.3875(lit.) | | Fp | 130 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless | | BRN | 1910689 | | Stability: | Stable, but reacts violently with water. Combustible. Incompatible with strong oxidising agents, alcohols, strong bases. | | InChI | InChI=1S/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 | | InChIKey | WFDIJRYMOXRFFG-WFGJKAKNSA-N | | SMILES | O(C(=O)C([2H])([2H])[2H])C(=O)C([2H])([2H])[2H] | | CAS Number Unlabeled | 108-24-7 |
| Hazard Codes | C | | Risk Statements | 10-34-20/22 | | Safety Statements | 26-45-36/37/39 | | RIDADR | UN 1715 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 28459010 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1B |
| | ACETIC ANHYDRIDE-D6 Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | Acetic Anhydride-d6 is the labeled analog of acetic anhydride, a reagent used generally in acetylation reactions in organic chemistry, primarily cellulose acetate and film material. |
| | ACETIC ANHYDRIDE-D6 Preparation Products And Raw materials |
|