- Acetic acid
-
- $119.00
-
2026-07-28
- CAS:1186-52-3
- Min. Order: 10g
- Purity: 0.99
- Supply Ability: 25kg
|
| | ACETIC ACID-D4 Basic information |
| | ACETIC ACID-D4 Chemical Properties |
| Melting point | 15-16 °C(lit.) | | Melting point | 16,7°C | | Boiling point | 118°C | | Boiling point | 115.5 °C(lit.) | | density | 1.119 g/mL at 25 °C(lit.) | | density | d = 1,12 | | vapor density | 2.07 (vs air) | | vapor pressure | 11.4 mm Hg ( 20 °C) | | refractive index | n20/D 1.368(lit.) | | Fp | 104 °F | | storage temp. | Flammables area | | solubility | Benzene | | pka | pK1: 5.32(Sol. D2O) | | form | Liquid | | color | Colorless | | Specific Gravity | 1.12 | | PH | 2.5 (50g/l, H2O, 25℃) | | explosive limit | 4-19.9%(V) | | Water Solubility | Soluble in water, ethanol and ether. | | Sensitive | Moisture Sensitive | | BRN | 1748971 | | Stability: | Stable. Incompatible with acids, bases, oxidizing agents, carbonates and phosphates, hydroxides, metals, oxides, acid anhydrides, peroxides, permanganates, amines, alcohols. Protect from moisture. Flammable. | | InChI | 1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD | | InChIKey | QTBSBXVTEAMEQO-GUEYOVJQSA-N | | SMILES | [2H]OC(=O)C([2H])([2H])[2H] | | CAS DataBase Reference | 1186-52-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 10-35 | | Safety Statements | 23-26-45 | | RIDADR | UN 2789 8/PG 2 | | WGK Germany | 3 | | F | 10 | | Autoignition Temperature | 800 °F | | HazardClass | 8 | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1A |
| | ACETIC ACID-D4 Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | (Acetic acid-D4) Labelled Acetic Acid is used for analysis and profiling of biological samples resolved through NMR spectroscopy. It helps with the labelling of RNA for high resolution NMR. | | Uses | Acetic acid-d{4} is used as a deuterated, polar and protic solvent, in food preservatives, PH control agent, flavor enhancer. | | Uses | Acetic acid-d4 may be used in the synthesis of deuterated (7E,9Z)-CLA (conjugated linoleic acid) and Pr(CD3COO)3.D2O (deuterium analog of praseodymium (III) acetate hydrate). | | Definition | ChEBI: Acetic acid-d4 is a deuterated compound and a monocarboxylic acid. | | General Description | Acetic acid-d4 (deuterated acetic acid) is a deuterated NMR solvent containing 0.03% (v/v) TMS (tetramethylsilane). It is useful in NMR-based research and analyses. Its dissociation constant in deuterium oxide has been obtained over a range of temperature by emf method. |
| | ACETIC ACID-D4 Preparation Products And Raw materials |
|