| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,3-DIFLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Chemical Properties |
| Melting point | -20°C | | Boiling point | 104°C | | density | 1,47 g/cm3 | | refractive index | 1.3860-1.3900 | | Fp | 28°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | pka | -5.28±0.20(Predicted) | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C6H2F5N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H | | InChIKey | XIFCGIKPAAZFFS-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(C(F)(F)F)C=C1F | | CAS DataBase Reference | 89402-42-6(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 10-36-25 | | Safety Statements | 16-45-26 | | RIDADR | 1993 | | WGK Germany | WGK 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Liq. 3 |
| | 2,3-DIFLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Usage And Synthesis |
| Description | 2,3-Difluoro-5-(trifluoromethyl)pyridine is a useful research chemical. | | Uses | 2,3-Difluoro-5-(trifluoroMethyl)pyridine is a heterocyclic compound and can be used as a pharmaceutical intermediate. | | Synthesis | The general procedure for the synthesis of 2,3-dichloro-5-trifluoromethylpyridine from 2,3-dichloro-5-trifluoromethylpyridine is as follows: 1500 mL of DMSO, 363 g of cesium fluoride, and 8 g of potassium carbonate were added to a 5000 mL reaction flask and heated in an oil bath. Concentrate and cool 600 mL of DMSO under reduced pressure to below 80 °C. Under nitrogen protection, 318 g (1.58 mol) of 2,3-dichloro-5-trifluoromethylpyridine was added to the reaction system and the reaction was carried out at about 110 °C for 48 hours. After completion of the reaction, 600 mL of water was added to the yellow liquid for liquid-liquid separation. The organic phase was dried with anhydrous magnesium sulfate and filtered to give a crude product of 188 g. The 100-102 °C fractions were collected by distillation to give 139 g of 2,3-difluoro-5-trifluoromethylpyridine in 47.6% yield. | | References | [1] Patent: CN104628679, 2018, B. Location in patent: Paragraph 0061; 0064; 0065 [2] Patent: US2008/221327, 2008, A1. Location in patent: Page/Page column 6; 9 |
| | 2,3-DIFLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Preparation Products And Raw materials |
|