|
|
| | 3-CHLORO-2-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Basic information |
| | 3-CHLORO-2-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Chemical Properties |
| Melting point | 16-20 °C (lit.) | | Boiling point | 50-55 °C/11 mmHg (lit.) | | density | 1.524 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.433(lit.) | | Fp | 125 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Colorless | | InChI | InChI=1S/C6H2ClF4N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H | | InChIKey | GDSROTVTTLUHCO-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(C(F)(F)F)C=C1Cl | | CAS DataBase Reference | 72537-17-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29333990 |
| | 3-CHLORO-2-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Usage And Synthesis |
| General Description | 3-Chloro-2-fluoro-5-(trifluoromethyl)pyridine, a halogenated pyridine derivative, is a fluorinated building block. It participates in the synthesis of 2,3-difluoro-5-(trifluoromethyl)pyridine. | | Synthesis | The general procedure for the synthesis of 3-chloro-2-fluoro-5-(trifluoromethyl)pyridine from 2,3-dichloro-5-trifluoromethylpyridine is as follows:
Example 3b.
Equipment: 250 mL four-necked round-bottomed flask equipped with a thermometer, mechanical stirrer, dropping funnel and inert gas inlet.
Operating steps:
1. 25 mL of DMSO was added to a 250 mL four-necked round-bottomed flask, and the solvent was evaporated from a suspension of 150 mL of DMSO, 2.5 g of potassium carbonate (17.9 mmol), and 25.0 g of cesium fluoride (162.9 mmol) at 120 °C and 25-30 mbar pressure.
2. 25.0 g of 2,3-dichloro-5-trifluoromethylpyridine (112.3 mmol) was added to the reaction mixture and the reaction was stirred at 120 °C for 4 hours.
3. After completion of the reaction, the suspension was filtered and the product 3-chloro-2-fluoro-5-(trifluoromethyl)pyridine was distilled directly from the distillate at 95 to 115 °C and 40-60 mbar pressure to obtain the product in quantitative yield.
PRODUCT ANALYSIS: GC analysis showed a product purity of 96.9 area percent. | | References | [1] Patent: US2008/221327, 2008, A1. Location in patent: Page/Page column 9-10
[2] Patent: US2008/221327, 2008, A1. Location in patent: Page/Page column 6
[3] Patent: CN107286087, 2017, A. Location in patent: Paragraph 0032; 0033
[4] Patent: CN106905231, 2017, A. Location in patent: Paragraph 0077; 0078; 0079; 0080; 0081; 0082; 0083-0085
[5] Patent: EP1199305, 2002, A1. Location in patent: Page 6 |
| | 3-CHLORO-2-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE Preparation Products And Raw materials |
|