- 2-Cyano-3,5-difluoropyridine
-
- $15.00 / 1KG
-
2021-07-02
- CAS:298709-29-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-Cyano-3,5-difluoropyridine Basic information | | Appearance |
| Product Name: | 2-Cyano-3,5-difluoropyridine | | Synonyms: | 3,5-Difluoropicolinitrile;3,5-Difluoropyridine-2-carbonitrile;3,5-DIFLURO-2-CYANOPYRIDINE;2-Pyridinecarbonitrile,3,5-difluoro-(9CI);2-Cyano-3,5-difluoropyridine, 3,5-Difluoropicolinonitrile;3,5-DIFLUORO-2-PYRIDINECARBONITRILE;2-Cyano-3,5-difluorpyridine;3,5-difluoronicotinonitrile | | CAS: | 298709-29-2 | | MF: | C6H2F2N2 | | MW: | 140.09 | | EINECS: | 678-766-6 | | Product Categories: | Pyridine series;Pyridines;API intermediates;HALIDE;PYRIDINE;NITRILE;Fluorine series | | Mol File: | 298709-29-2.mol |  |
| | 2-Cyano-3,5-difluoropyridine Chemical Properties |
| Melting point | 32-34°C | | Boiling point | 187.8±35.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | Fp | 90℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | -5.16±0.20(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C6H2F2N2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H | | InChIKey | WLBIFECTHKFYKV-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC=C(F)C=C1F | | CAS DataBase Reference | 298709-29-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/38-41-37/38-22 | | Safety Statements | 26-36/37/39-39 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-Cyano-3,5-difluoropyridine Usage And Synthesis |
| Appearance | 2-Cyano-3,5-difluoropyridine is a white to Orange to Green powder to crystal. | | Description | 2-Cyano-3,5-difluoropyridine is a difluorinated cyanopyridine compound exhibiting high electron-withdrawing properties. Consequently, its fluorine substituents readily undergo nucleophilic aromatic substitution reactions. This characteristic renders the compound extensively utilised in pharmaceutical synthesis, electronic materials, and organic synthesis applications. | | Uses | 2-Cyano-3,5-difluoropyridine is a versatile reactant used in the preparation of potent and selective inhibitors of DPP-4 that exhibit an attractive pharmacokinetic profile as antidiabetics. |
| | 2-Cyano-3,5-difluoropyridine Preparation Products And Raw materials |
|