|
|
| | 2-Aminotoluene-5-sulfonic acid Basic information |
| | 2-Aminotoluene-5-sulfonic acid Chemical Properties |
| Melting point | 290°C | | density | 1.3553 (rough estimate) | | refractive index | 1.6100 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | pK1: 3.125 (25°C) | | form | powder | | color | Faint beige to faint red/orange | | Water Solubility | 5g/L(20 ºC) | | InChI | InChI=1S/C7H9NO3S/c1-5-4-6(12(9,10)11)2-3-7(5)8/h2-4H,8H2,1H3,(H,9,10,11) | | InChIKey | WQTCZINVPXJNEL-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(N)C(C)=C1 | | LogP | 0.076 at 25℃ | | CAS DataBase Reference | 98-33-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-amino-3-methyl- (98-33-9) |
| Hazard Codes | T | | Risk Statements | 45-34 | | Safety Statements | 53-26-36/37/39-45 | | RIDADR | 2811 | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921420090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Aminotoluene-5-sulfonic acid Usage And Synthesis |
| Description | 2-Aminotoluene-5-sulfonic acid is prepared from o-toluidine and 98 % H2SO4 via the sulfate, which is then baked. The sodium salt can be isolated after liming and precipitation of calcium sulfate. The solution can be used directly in the manufacture of dyes.
| | Physical properties | White to Pale-yellow to Yellow-brown Sticky Oil to Semi-Solid. | | Flammability and Explosibility | Not classified |
| | 2-Aminotoluene-5-sulfonic acid Preparation Products And Raw materials |
|