CYCLO(-PHE-PHE) manufacturers
- CYCLO(-PHE-PHE)
-
-
2025-12-01
- CAS:2862-51-3
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
|
| | CYCLO(-PHE-PHE) Basic information |
| Product Name: | CYCLO(-PHE-PHE) | | Synonyms: | CYCLO(-PHE-PHE);CYCLO(L-PHE-L-PHE);Cyclo(L-Phe-L-Phe)≥ 99% (TLC);cyclo(L-phenylalanyl-L-phenylalanyl);cyclo(phenylalanyl-phenylalanyl);CYCLO-L-(L-PHE-L-PHE);(3S)-3α,6α-Dibenzylpiperazine-2,5-dione;(3S,6S)-3,6-Dibenzyl-2,5-piperazinedione | | CAS: | 2862-51-3 | | MF: | C18H18N2O2 | | MW: | 294.35 | | EINECS: | | | Product Categories: | | | Mol File: | 2862-51-3.mol |  |
| | CYCLO(-PHE-PHE) Chemical Properties |
| Melting point | 315-316 °C | | Boiling point | 594.2±43.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 12.88±0.60(Predicted) | | Sequence | Cyclo(Phe-Phe) | | InChI | InChI=1S/C18H18N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,22)(H,20,21)/t15-,16-/m0/s1 | | InChIKey | JUAPMRSLDANLAS-HOTGVXAUSA-N | | SMILES | N1[C@@H](CC2=CC=CC=C2)C(=O)N[C@@H](CC2=CC=CC=C2)C1=O |
| | CYCLO(-PHE-PHE) Usage And Synthesis |
| Chemical Properties | White powder | | Uses | It is found in chicken essence, is a dual inhibitor of the serotonin transporter, and acetylcholinesterase. | | Uses | Cyclo(-Phe-Phe) can be used as anti-biofilm and anti-adherence against oral pathogens. | | Definition | ChEBI: A member of the class of 2,5-diketopiperazines that is piperazine-2,5-dione in which one hydrogen at position 3 and one hydrogen at position 6 are replaced by benzyl groups (the 3S,6S-diastereomer). |
| | CYCLO(-PHE-PHE) Preparation Products And Raw materials |
|