|
|
| | 2-Amino-5-carbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester Basic information |
| | 2-Amino-5-carbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester Chemical Properties |
| Melting point | 181-182 °C | | Boiling point | 323.3±42.0 °C(Predicted) | | density | 1.338±0.06 g/cm3(Predicted) | | pka | 16.08±0.50(Predicted) | | InChI | InChI=1S/C9H12N2O3S/c1-3-14-9(13)5-4(2)6(7(10)12)15-8(5)11/h3,11H2,1-2H3,(H2,10,12) | | InChIKey | KZNNKLUXBNFFLZ-UHFFFAOYSA-N | | SMILES | C1(N)SC(C(N)=O)=C(C)C=1C(OCC)=O |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 2-Amino-5-carbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Amino-5-carbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|