| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1H-Indole-7-carboxylic acid Basic information |
| | 1H-Indole-7-carboxylic acid Chemical Properties |
| Melting point | 202 °C | | Boiling point | 419.6±18.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.55±0.10(Predicted) | | color | White to Gray to Brown | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C9H7NO2/c11-9(12)7-3-1-2-6-4-5-10-8(6)7/h1-5,10H,(H,11,12) | | InChIKey | IPDOBVFESNNYEE-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2C(O)=O)C=C1 | | CAS DataBase Reference | 1670-83-3(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Indole-7-carboxylic acid (1670-83-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1H-Indole-7-carboxylic acid Usage And Synthesis |
| Uses | Indole-7-carboxylic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | 1H-Indole-7-carboxylic acid Preparation Products And Raw materials |
|