| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Basic information |
| Product Name: | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE | | Synonyms: | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE;2-TERT-BUTYLAMINO-1-(4-HYDROXY-3-HYDROXYMETHYLPHENYL)-ETHANONE;Albuterol sulfate iMpurity: 2-[(1,1-diMethylethyl) aMino]-1-[4-OH-3-(hydroxyMethyl)phenyl]ethan- 1-one;Albuterol Related CoMpound B;2-[(1,1-Dimethylethyl)amino]-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone;Salbutamol impurity 9/Salbutamol EP Impurity J/2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone;Albuterol Related Compound B (10 mg) (2-(tert-butylamino)-1-[4-hydroxy-3-(hydroxymethyl)phenyl]ethanone);Ethanone, 2-[(1,1-dimethylethyl)amino]-1-[4-hydroxy-3-(hydroxymethyl)phenyl]- | | CAS: | 156547-62-5 | | MF: | C13H19NO3 | | MW: | 237.29 | | EINECS: | | | Product Categories: | | | Mol File: | 156547-62-5.mol | ![2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Structure](CAS/GIF/156547-62-5.gif) |
| | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Chemical Properties |
| Boiling point | 376.8±21.0 °C(Predicted) | | density | 1.140±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 7.44±0.20(Predicted) | | form | powder | | Major Application | pharmaceutical pharmaceutical small molecule | | InChI | 1S/C13H19NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,14-16H,7-8H2,1-3H3 | | InChIKey | WHJAFZHZZCVHJI-UHFFFAOYSA-N | | SMILES | N(C(C)(C)C)CC(=O)c1cc(c(cc1)O)CO |
| WGK Germany | WGK 3 | | HS Code | 2922504500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Usage And Synthesis |
| Uses | Salbutamol ketone impurity BP Reference standard, intended for use in laboratory tests only as specifically prescribed in the British Pharmacopoeia. Also used in monographs such as:Salbutamol InjectionSalbutamol Nebuliser Solution |
| | 2-[(1,1-DIMETHYLETHYL) AMINO]-1-[4-OH-3-(HYDROXYMETHYL)PHENYL]ETHAN-1-ONE Preparation Products And Raw materials |
|