|
|
| | Prednisone Impurity 13 Basic information |
| Product Name: | Prednisone Impurity 13 | | Synonyms: | Prednisone Impurity 13;9α-bromo-11β,16α,17α,21-tetrahydroxypregnane-1,4-diene-3,20-dione-21-acetate;BNKY015-BD02;(11β,16α)-21-(Acetyloxy)-9-bromo-11,16,17-trihydroxy-pregna-1,4-diene-3,20-dione;Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9-bromo-11,16,17-trihydroxy-, (11β,16α)-;Prednisone Impurity 5;Budesonide Impurity 53;((8S,9R,10S,11S,13S,14S,16R,17S)-9-bromo-11,16,17-trihydroxy-10,13-dimethyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl acetate | | CAS: | 91160-89-3 | | MF: | C23H29BrO7 | | MW: | 497.38 | | EINECS: | | | Product Categories: | | | Mol File: | 91160-89-3.mol |  |
| | Prednisone Impurity 13 Chemical Properties |
| Boiling point | 636.3±55.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | pka | 11.57±0.70(Predicted) | | InChIKey | LTRVYEKAPGRFOX-WFWLZCIZNA-N | | SMILES | C[C@]12C[C@H](O)[C@@]3([C@]4(C=CC(=O)C=C4CC[C@@]3([H])[C@]1([H])C[C@@H](O)[C@]2(O)C(=O)COC(=O)C)C)Br |&1:1,3,5,6,15,17,20,22,r| |
| | Prednisone Impurity 13 Usage And Synthesis |
| Uses | (11β,16α)-21-(Acetyloxy)-9-bromo-11,16,17-trihydroxy-pregna-1,4-diene-3,20-dione is used as a reactant in the synthesis of triamcinolone acetonide, a synthetic corticosteroid used to treat skin conditions. | | Synthesis |
50.5 g of 2-((8S,10S,13S,14S,16R,17S)-16,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,10,12,13,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl acetate was dissolved in 1500 ml of acetone, 70 ml of 5% perchloric acid was added, the temperature was lowered to 0°C with stirring, and 45 g of N-bromosuccinimide was added and stirred After the reaction was completed, 50 ml of 20% sodium sulfite aqueous solution was added, the acetone was concentrated, the water was separated, filtered, and dried to obtain 62 g of Prednisone Impurity 13 (9α-bromo-11β,16α,17α,21-tetrahydroxypregnane-1,4-diene-3,20-dione-21-acetate).
|
| | Prednisone Impurity 13 Preparation Products And Raw materials |
|